C21H14N3O5S- — CID 71774705
9-[4-(aminocarbamothioylamino)-2-carboxyphenyl]-6-oxoxanthen-3-olate (PubChem CID 71774705) has the molecular formula C21H14N3O5S- and a molecular weight of 420.43 g/mol. Its IUPAC name is 9-[4-(aminocarbamothioylamino)-2-carboxyphenyl]-6-oxoxanthen-3-olate.
| Compound Name | 9-[4-(aminocarbamothioylamino)-2-carboxyphenyl]-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 71774705 |
| Molecular Formula | C21H14N3O5S- |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 9-[4-(aminocarbamothioylamino)-2-carboxyphenyl]-6-oxoxanthen-3-olate |
| SMILES | NNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc([O-])ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H15N3O5S/c22-24-21(30)23-10-1-4-13(16(7-10)20(27)28)19-14-5-2-11(25)8-17(14)29-18-9-12(26)3-6-15(18)19/h1-9,25H,22H2,(H,27,28)(H2,23,24,30)/p-1 |
| InChIKey | MEUCHQDLZYLNQY-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|