C34H33N4O14- — CID 102095945
9-[4-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-2-carboxyphenyl]-6-oxoxanthen-3-olate (PubChem CID 102095945) has the molecular formula C34H33N4O14- and a molecular weight of 721.65 g/mol. Its IUPAC name is 9-[4-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-2-carboxyphenyl]-6-oxoxanthen-3-olate.
| Compound Name | 9-[4-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-2-carboxyphenyl]-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 102095945 |
| Molecular Formula | C34H33N4O14- |
| Molecular Weight | 721.65 g/mol |
| Exact Mass | 721.20 |
| IUPAC Name | 9-[4-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-2-carboxyphenyl]-6-oxoxanthen-3-olate |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc([O-])ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H34N4O14/c39-20-2-5-23-26(12-20)52-27-13-21(40)3-6-24(27)33(23)22-4-1-19(11-25(22)34(50)51)35-28(41)14-37(16-30(44)45)9-7-36(15-29(42)43)8-10-38(17-31(46)47)18-32(48)49/h1-6,11-13,39H,7-10,14-18H2,(H,35,41)(H,42,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)/p-1 |
| InChIKey | WBKAYPGLJBIDCB-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 278.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.65 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|