C31H23NO8S — CID 89328492
5-[[2-(2-carboxyethylsulfanyl)-2-phenylacetyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 89328492) has the molecular formula C31H23NO8S and a molecular weight of 569.59 g/mol. Its IUPAC name is 5-[[2-(2-carboxyethylsulfanyl)-2-phenylacetyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[2-(2-carboxyethylsulfanyl)-2-phenylacetyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 89328492 |
| Molecular Formula | C31H23NO8S |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | 5-[[2-(2-carboxyethylsulfanyl)-2-phenylacetyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)CCSC(C(=O)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C31H23NO8S/c33-19-7-10-22-25(15-19)40-26-16-20(34)8-11-23(26)28(22)21-9-6-18(14-24(21)31(38)39)32-30(37)29(41-13-12-27(35)36)17-4-2-1-3-5-17/h1-11,14-16,29,33H,12-13H2,(H,32,37)(H,35,36)(H,38,39) |
| InChIKey | RJLRZWMHTPKIQX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|