C27H26N2O10S — CID 89049917
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamothioylamino]benzoic acid (PubChem CID 89049917) has the molecular formula C27H26N2O10S and a molecular weight of 570.58 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 89049917 |
| Molecular Formula | C27H26N2O10S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NC(=S)NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)ccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C27H26N2O10S/c30-11-20(34)25(36)24(35)19(33)10-28-27(40)29-12-1-4-15(18(7-12)26(37)38)23-16-5-2-13(31)8-21(16)39-22-9-14(32)3-6-17(22)23/h1-9,19-20,24-25,30-31,33-36H,10-11H2,(H,37,38)(H2,28,29,40)/t19-,20-,24-,25-/m1/s1 |
| InChIKey | RBOHNBQASQXKJE-GQUJEBGOSA-N |
| XLogP | 0.69 |
| TPSA | 212.95 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|