C26H22N2O6S — CID 90143795
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(4-oxopentan-2-ylcarbamothioylamino)benzoic acid (PubChem CID 90143795) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(4-oxopentan-2-ylcarbamothioylamino)benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(4-oxopentan-2-ylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 90143795 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-(4-oxopentan-2-ylcarbamothioylamino)benzoic acid |
| SMILES | CC(=O)CC(C)NC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H22N2O6S/c1-13(9-14(2)29)27-26(35)28-15-3-6-18(21(10-15)25(32)33)24-19-7-4-16(30)11-22(19)34-23-12-17(31)5-8-20(23)24/h3-8,10-13,30H,9H2,1-2H3,(H,32,33)(H2,27,28,35) |
| InChIKey | SJRGITVYUDXYGH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|