C23H17N2O5S2- — CID 101432956
9-[2-carboxy-4-(2-sulfanylethylcarbamothioylamino)phenyl]-6-oxoxanthen-3-olate (PubChem CID 101432956) has the molecular formula C23H17N2O5S2- and a molecular weight of 465.53 g/mol. Its IUPAC name is 9-[2-carboxy-4-(2-sulfanylethylcarbamothioylamino)phenyl]-6-oxoxanthen-3-olate.
| Compound Name | 9-[2-carboxy-4-(2-sulfanylethylcarbamothioylamino)phenyl]-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 101432956 |
| Molecular Formula | C23H17N2O5S2- |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 9-[2-carboxy-4-(2-sulfanylethylcarbamothioylamino)phenyl]-6-oxoxanthen-3-olate |
| SMILES | O=C(O)c1cc(NC(=S)NCCS)ccc1-c1c2ccc(=O)cc-2oc2cc([O-])ccc12 |
| InChI | InChI=1S/C23H18N2O5S2/c26-13-2-5-16-19(10-13)30-20-11-14(27)3-6-17(20)21(16)15-4-1-12(9-18(15)22(28)29)25-23(32)24-7-8-31/h1-6,9-11,26,31H,7-8H2,(H,28,29)(H2,24,25,32)/p-1 |
| InChIKey | VJBLZAOXOQDIPF-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|