C20H12NO5- — CID 54712934
9-(4-amino-3-carboxyphenyl)-6-oxoxanthen-3-olate (PubChem CID 54712934) has the molecular formula C20H12NO5- and a molecular weight of 346.32 g/mol. Its IUPAC name is 9-(4-amino-3-carboxyphenyl)-6-oxoxanthen-3-olate.
| Compound Name | 9-(4-amino-3-carboxyphenyl)-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 54712934 |
| Molecular Formula | C20H12NO5- |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 9-(4-amino-3-carboxyphenyl)-6-oxoxanthen-3-olate |
| SMILES | Nc1ccc(-c2c3ccc(=O)cc-3oc3cc([O-])ccc23)cc1C(=O)O |
| InChI | InChI=1S/C20H13NO5/c21-16-6-1-10(7-15(16)20(24)25)19-13-4-2-11(22)8-17(13)26-18-9-12(23)3-5-14(18)19/h1-9,22H,21H2,(H,24,25)/p-1 |
| InChIKey | UQERWVCWWZALRG-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|