C23H21N2O6- — CID 161121265
azanium;methane;5-(methylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate (PubChem CID 161121265) has the molecular formula C23H21N2O6- and a molecular weight of 421.43 g/mol. Its IUPAC name is azanium;methane;5-(methylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate.
| Compound Name | azanium;methane;5-(methylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 161121265 |
| Molecular Formula | C23H21N2O6- |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | azanium;methane;5-(methylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate |
| SMILES | C.CNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc([O-])ccc23)c(C(=O)[O-])c1.[NH4+] |
| InChI | InChI=1S/C22H15NO6.CH4.H3N/c1-23-21(26)11-2-5-14(17(8-11)22(27)28)20-15-6-3-12(24)9-18(15)29-19-10-13(25)4-7-16(19)20;;/h2-10,24H,1H3,(H,23,26)(H,27,28);1H4;1H3/p-1 |
| InChIKey | GXGBJJATZCXRHB-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|