C28H25NO6-2 — CID 59113869
4-(heptylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate (PubChem CID 59113869) has the molecular formula C28H25NO6-2 and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-(heptylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate.
| Compound Name | 4-(heptylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 59113869 |
| Molecular Formula | C28H25NO6-2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-(heptylcarbamoyl)-2-(3-oxido-6-oxoxanthen-9-yl)benzoate |
| SMILES | CCCCCCCNC(=O)c1ccc(C(=O)[O-])c(-c2c3ccc(=O)cc-3oc3cc([O-])ccc23)c1 |
| InChI | InChI=1S/C28H27NO6/c1-2-3-4-5-6-13-29-27(32)17-7-10-20(28(33)34)23(14-17)26-21-11-8-18(30)15-24(21)35-25-16-19(31)9-12-22(25)26/h7-12,14-16,30H,2-6,13H2,1H3,(H,29,32)(H,33,34)/p-2 |
| InChIKey | HXVRTCHOKFYKSQ-UHFFFAOYSA-L |
| XLogP | 3.70 |
| TPSA | 122.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|