C45H63ClN2O11 — CID 142932763
4-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;1,2-diethoxyethane;ethane (PubChem CID 142932763) has the molecular formula C45H63ClN2O11 and a molecular weight of 843.45 g/mol. Its IUPAC name is 4-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;1,2-diethoxyethane;ethane.
| Compound Name | 4-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;1,2-diethoxyethane;ethane |
|---|---|
| PubChem CID | 142932763 |
| Molecular Formula | C45H63ClN2O11 |
| Molecular Weight | 843.45 g/mol |
| Exact Mass | 842.41 |
| IUPAC Name | 4-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;1,2-diethoxyethane;ethane |
| SMILES | CC.CCOCCOCC.O=C(CCCCCNC(=O)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1)NCCOCCOCCCCCCCl |
| InChI | InChI=1S/C37H43ClN2O9.C6H14O2.C2H6/c38-15-5-1-2-7-18-47-20-21-48-19-17-39-34(43)8-4-3-6-16-40-36(44)25-9-12-28(37(45)46)31(22-25)35-29-13-10-26(41)23-32(29)49-33-24-27(42)11-14-30(33)35;1-3-7-5-6-8-4-2;1-2/h9-14,22-24,41H,1-8,15-21H2,(H,39,43)(H,40,44)(H,45,46);3-6H2,1-2H3;1-2H3 |
| InChIKey | JMNCYKNVMLOIOB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 182.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.45 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|