C26H19NO9 — CID 58362055
5-[(4-carboxy-4-oxobutyl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 58362055) has the molecular formula C26H19NO9 and a molecular weight of 489.44 g/mol. Its IUPAC name is 5-[(4-carboxy-4-oxobutyl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[(4-carboxy-4-oxobutyl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 58362055 |
| Molecular Formula | C26H19NO9 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 5-[(4-carboxy-4-oxobutyl)carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)C(=O)CCCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H19NO9/c28-14-4-7-17-21(11-14)36-22-12-15(29)5-8-18(22)23(17)16-6-3-13(10-19(16)25(32)33)24(31)27-9-1-2-20(30)26(34)35/h3-8,10-12,28H,1-2,9H2,(H,27,31)(H,32,33)(H,34,35) |
| InChIKey | DRHZZNSMRDBVDF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|