C37H33N3O8 — CID 102403956
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-[4-(5-methyl-6-oxo-1H-pyridin-3-yl)but-2-ynylamino]-6-oxohexyl]carbamoyl]benzoic acid (PubChem CID 102403956) has the molecular formula C37H33N3O8 and a molecular weight of 647.68 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-[4-(5-methyl-6-oxo-1H-pyridin-3-yl)but-2-ynylamino]-6-oxohexyl]carbamoyl]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-[4-(5-methyl-6-oxo-1H-pyridin-3-yl)but-2-ynylamino]-6-oxohexyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 102403956 |
| Molecular Formula | C37H33N3O8 |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[6-[4-(5-methyl-6-oxo-1H-pyridin-3-yl)but-2-ynylamino]-6-oxohexyl]carbamoyl]benzoic acid |
| SMILES | Cc1cc(CC#CCNC(=O)CCCCCNC(=O)c2ccc(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)c(C(=O)O)c2)c[nH]c1=O |
| InChI | InChI=1S/C37H33N3O8/c1-22-17-23(21-40-35(22)44)7-4-6-15-38-33(43)8-3-2-5-16-39-36(45)24-9-12-27(30(18-24)37(46)47)34-28-13-10-25(41)19-31(28)48-32-20-26(42)11-14-29(32)34/h9-14,17-21,41H,2-3,5,7-8,15-16H2,1H3,(H,38,43)(H,39,45)(H,40,44)(H,46,47) |
| InChIKey | YZAOPEHANJPKEI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 178.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|