C50H45N4O8+ — CID 89003496
[9-[2-carboxy-4-[5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]pentylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 89003496) has the molecular formula C50H45N4O8+ and a molecular weight of 829.93 g/mol. Its IUPAC name is [9-[2-carboxy-4-[5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]pentylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-4-[5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]pentylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 89003496 |
| Molecular Formula | C50H45N4O8+ |
| Molecular Weight | 829.93 g/mol |
| Exact Mass | 829.32 |
| IUPAC Name | [9-[2-carboxy-4-[5-[[4-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]amino]pentylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCCCCNC(=O)c4ccc(-c5c6ccc(=O)cc-6oc6cc(O)ccc56)cc4)cc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C50H44N4O8/c1-53(2)32-13-18-39-42(25-32)61-43-26-33(54(3)4)14-19-40(43)47(39)36-17-12-31(24-41(36)50(59)60)49(58)52-23-7-5-6-22-51-48(57)30-10-8-29(9-11-30)46-37-20-15-34(55)27-44(37)62-45-28-35(56)16-21-38(45)46/h8-21,24-28H,5-7,22-23H2,1-4H3,(H3-,51,52,55,56,57,58,59,60)/p+1 |
| InChIKey | CNWWDFRASFVSDZ-UHFFFAOYSA-O |
| XLogP | 7.91 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.93 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|