C32H38N5O6+ — CID 11671607
[9-[4-[5-[(2-aminooxyacetyl)amino]pentylcarbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 11671607) has the molecular formula C32H38N5O6+ and a molecular weight of 600.59 g/mol. Its IUPAC name is [9-[4-[5-[(2-aminooxyacetyl)amino]pentylcarbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[4-[5-[(2-aminooxyacetyl)amino]pentylcarbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 11671607 |
| Molecular Formula | C32H38N5O6+ |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | [9-[4-[5-[(2-aminooxyacetyl)amino]pentylcarbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)[13c]1[13cH][13cH][13c]2c(-c3ccc(C(=O)NCCCCCNC(=O)CON)cc3C(=O)O)[13c]3[13cH][13cH][13c](=[N+](C)C)[13cH][13c]-3o[13c]2[13cH]1 |
| InChI | InChI=1S/C32H37N5O6/c1-36(2)21-9-12-24-27(17-21)43-28-18-22(37(3)4)10-13-25(28)30(24)23-11-8-20(16-26(23)32(40)41)31(39)35-15-7-5-6-14-34-29(38)19-42-33/h8-13,16-18H,5-7,14-15,19,33H2,1-4H3,(H2-,34,35,38,39,40,41)/p+1/i9+1,10+1,12+1,13+1,17+1,18+1,21+1,22+1,24+1,25+1,27+1,28+1 |
| InChIKey | HWNZSZBGCRTQBR-NUMUUPHVSA-O |
| XLogP | 2.91 |
| TPSA | 150.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|