C37H47FN3O6P — CID 139035304
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[10-[ethoxy(fluoro)phosphoryl]decylcarbamoyl]benzoate (PubChem CID 139035304) has the molecular formula C37H47FN3O6P and a molecular weight of 679.77 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[10-[ethoxy(fluoro)phosphoryl]decylcarbamoyl]benzoate.
| Compound Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[10-[ethoxy(fluoro)phosphoryl]decylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 139035304 |
| Molecular Formula | C37H47FN3O6P |
| Molecular Weight | 679.77 g/mol |
| Exact Mass | 679.32 |
| IUPAC Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[10-[ethoxy(fluoro)phosphoryl]decylcarbamoyl]benzoate |
| SMILES | CCOP(=O)(F)CCCCCCCCCCNC(=O)c1ccc(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C37H47FN3O6P/c1-6-46-48(38,45)22-14-12-10-8-7-9-11-13-21-39-36(42)26-15-18-29(32(23-26)37(43)44)35-30-19-16-27(40(2)3)24-33(30)47-34-25-28(41(4)5)17-20-31(34)35/h15-20,23-25H,6-14,21-22H2,1-5H3,(H-,39,42,43,44) |
| InChIKey | JEVJWIYMEMUCFU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.77 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|