C39H46N4O7 — CID 164540428
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[(2S,5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]methoxycarbonylamino]pentylcarbamoyl]benzoate (PubChem CID 164540428) has the molecular formula C39H46N4O7 and a molecular weight of 682.82 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[(2S,5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]methoxycarbonylamino]pentylcarbamoyl]benzoate.
| Compound Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[(2S,5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]methoxycarbonylamino]pentylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 164540428 |
| Molecular Formula | C39H46N4O7 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.34 |
| IUPAC Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[(2S,5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]methoxycarbonylamino]pentylcarbamoyl]benzoate |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCCCCNC(=O)OC[C@@H]4CC/C=C\CCO4)cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C39H46N4O7/c1-42(2)27-14-17-31-34(23-27)50-35-24-28(43(3)4)15-18-32(35)36(31)30-16-13-26(22-33(30)38(45)46)37(44)40-19-9-7-10-20-41-39(47)49-25-29-12-8-5-6-11-21-48-29/h5-6,13-18,22-24,29H,7-12,19-21,25H2,1-4H3,(H2-,40,41,44,45,46,47)/b6-5-/t29-/m0/s1 |
| InChIKey | RFXHFVBXKFDHGG-ATPFBAARSA-N |
| XLogP | 4.42 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|