C40H48N4O6 — CID 174193234
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[2-(1-hydroxycyclooct-4-en-1-yl)acetyl]amino]pentylcarbamoyl]benzoate (PubChem CID 174193234) has the molecular formula C40H48N4O6 and a molecular weight of 680.85 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[2-(1-hydroxycyclooct-4-en-1-yl)acetyl]amino]pentylcarbamoyl]benzoate.
| Compound Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[2-(1-hydroxycyclooct-4-en-1-yl)acetyl]amino]pentylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 174193234 |
| Molecular Formula | C40H48N4O6 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[5-[[2-(1-hydroxycyclooct-4-en-1-yl)acetyl]amino]pentylcarbamoyl]benzoate |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCCCCNC(=O)CC4(O)CCC=CCCC4)cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C40H48N4O6/c1-43(2)28-14-17-31-34(24-28)50-35-25-29(44(3)4)15-18-32(35)37(31)30-16-13-27(23-33(30)39(47)48)38(46)42-22-12-8-11-21-41-36(45)26-40(49)19-9-6-5-7-10-20-40/h5-6,13-18,23-25,49H,7-12,19-22,26H2,1-4H3,(H2-,41,42,45,46,47,48) |
| InChIKey | YZWKVSJNBRBHTJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|