C36H36N4O9P- — CID 59010904
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[2-[3-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]propanoylamino]ethylcarbamoyl]benzoate (PubChem CID 59010904) has the molecular formula C36H36N4O9P- and a molecular weight of 699.68 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[2-[3-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]propanoylamino]ethylcarbamoyl]benzoate.
| Compound Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[2-[3-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]propanoylamino]ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 59010904 |
| Molecular Formula | C36H36N4O9P- |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 699.22 |
| IUPAC Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[2-[3-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]propanoylamino]ethylcarbamoyl]benzoate |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCNC(=O)CCc4ccc(OP(=O)([O-])O)cc4)cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C36H37N4O9P/c1-39(2)24-9-14-28-31(20-24)48-32-21-25(40(3)4)10-15-29(32)34(28)27-13-8-23(19-30(27)36(43)44)35(42)38-18-17-37-33(41)16-7-22-5-11-26(12-6-22)49-50(45,46)47/h5-6,8-15,19-21H,7,16-18H2,1-4H3,(H4-,37,38,41,42,43,44,45,46,47)/p-1 |
| InChIKey | PZCSPVGXWMVKLL-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 187.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|