C33H33N3O8P+ — CID 11456376
[9-[2-carboxy-5-[2-(4-phosphonooxyphenyl)ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 11456376) has the molecular formula C33H33N3O8P+ and a molecular weight of 630.61 g/mol. Its IUPAC name is [9-[2-carboxy-5-[2-(4-phosphonooxyphenyl)ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-5-[2-(4-phosphonooxyphenyl)ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 11456376 |
| Molecular Formula | C33H33N3O8P+ |
| Molecular Weight | 630.61 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | [9-[2-carboxy-5-[2-(4-phosphonooxyphenyl)ethylcarbamoyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3cc(C(=O)NCCc4ccc(OP(=O)(O)O)cc4)ccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C33H32N3O8P/c1-35(2)22-8-13-26-29(18-22)43-30-19-23(36(3)4)9-14-27(30)31(26)28-17-21(7-12-25(28)33(38)39)32(37)34-16-15-20-5-10-24(11-6-20)44-45(40,41)42/h5-14,17-19H,15-16H2,1-4H3,(H3-,34,37,38,39,40,41,42)/p+1 |
| InChIKey | WCIRBOOTVQOCJD-UHFFFAOYSA-O |
| XLogP | 4.44 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|