C30H35ClN4O4 — CID 53235883
[9-[4-(5-aminopentylcarbamoyl)-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride (PubChem CID 53235883) has the molecular formula C30H35ClN4O4 and a molecular weight of 551.09 g/mol. Its IUPAC name is [9-[4-(5-aminopentylcarbamoyl)-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride.
| Compound Name | [9-[4-(5-aminopentylcarbamoyl)-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 53235883 |
| Molecular Formula | C30H35ClN4O4 |
| Molecular Weight | 551.09 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | [9-[4-(5-aminopentylcarbamoyl)-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium chloride |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCCCCN)cc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C30H34N4O4.ClH/c1-33(2)20-9-12-23-26(17-20)38-27-18-21(34(3)4)10-13-24(27)28(23)22-11-8-19(16-25(22)30(36)37)29(35)32-15-7-5-6-14-31;/h8-13,16-18H,5-7,14-15,31H2,1-4H3,(H-,32,35,36,37);1H |
| InChIKey | GXWBJLNGNKBSRI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.09 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|