C30H31N3O6S2 — CID 21028180
5-[2-(2-carboxyethyldisulfanyl)ethylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate (PubChem CID 21028180) has the molecular formula C30H31N3O6S2 and a molecular weight of 593.73 g/mol. Its IUPAC name is 5-[2-(2-carboxyethyldisulfanyl)ethylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate.
| Compound Name | 5-[2-(2-carboxyethyldisulfanyl)ethylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 21028180 |
| Molecular Formula | C30H31N3O6S2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 5-[2-(2-carboxyethyldisulfanyl)ethylcarbamoyl]-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCSSCCC(=O)O)cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C30H31N3O6S2/c1-32(2)19-6-9-22-25(16-19)39-26-17-20(33(3)4)7-10-23(26)28(22)21-8-5-18(15-24(21)30(37)38)29(36)31-12-14-41-40-13-11-27(34)35/h5-10,15-17H,11-14H2,1-4H3,(H2-,31,34,35,36,37,38) |
| InChIKey | MYHAPVUEJPADET-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|