C24H22N2O3Sn — CID 175727431
CID 175727431 (PubChem CID 175727431) has the molecular formula C24H22N2O3Sn and a molecular weight of 505.16 g/mol.
| Compound Name | CID 175727431 |
|---|---|
| PubChem CID | 175727431 |
| Molecular Formula | C24H22N2O3Sn |
| Molecular Weight | 505.16 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc2c(-c3ccccc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1.[Sn] |
| InChI | InChI=1S/C24H22N2O3.Sn/c1-25(2)15-9-11-19-21(13-15)29-22-14-16(26(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(27)28;/h5-14H,1-4H3; |
| InChIKey | SOYXBCWCSCUQRZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|