C52H78N2O3 — CID 20760987
2-[3-(dioctylamino)-6-dioctylazaniumylidenexanthen-9-yl]benzoate (PubChem CID 20760987) has the molecular formula C52H78N2O3 and a molecular weight of 779.21 g/mol. Its IUPAC name is 2-[3-(dioctylamino)-6-dioctylazaniumylidenexanthen-9-yl]benzoate.
| Compound Name | 2-[3-(dioctylamino)-6-dioctylazaniumylidenexanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 20760987 |
| Molecular Formula | C52H78N2O3 |
| Molecular Weight | 779.21 g/mol |
| Exact Mass | 778.60 |
| IUPAC Name | 2-[3-(dioctylamino)-6-dioctylazaniumylidenexanthen-9-yl]benzoate |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc2c(-c3ccccc3C(=O)[O-])c3ccc(=[N+](CCCCCCCC)CCCCCCCC)cc-3oc2c1 |
| InChI | InChI=1S/C52H78N2O3/c1-5-9-13-17-21-27-37-53(38-28-22-18-14-10-6-2)43-33-35-47-49(41-43)57-50-42-44(34-36-48(50)51(47)45-31-25-26-32-46(45)52(55)56)54(39-29-23-19-15-11-7-3)40-30-24-20-16-12-8-4/h25-26,31-36,41-42H,5-24,27-30,37-40H2,1-4H3 |
| InChIKey | BHIXNZSSKOHBJK-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 59.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.21 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|