C47H62F6N3O2+ — CID 164544002
ethyl-[6-[ethyl(2,2,2-trifluoroethyl)amino]-9-[2-[methyl-[(E)-octadec-9-enyl]carbamoyl]phenyl]xanthen-3-ylidene]-(2,2,2-trifluoroethyl)azanium (PubChem CID 164544002) has the molecular formula C47H62F6N3O2+ and a molecular weight of 815.02 g/mol. Its IUPAC name is ethyl-[6-[ethyl(2,2,2-trifluoroethyl)amino]-9-[2-[methyl-[(E)-octadec-9-enyl]carbamoyl]phenyl]xanthen-3-ylidene]-(2,2,2-trifluoroethyl)azanium.
| Compound Name | ethyl-[6-[ethyl(2,2,2-trifluoroethyl)amino]-9-[2-[methyl-[(E)-octadec-9-enyl]carbamoyl]phenyl]xanthen-3-ylidene]-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 164544002 |
| Molecular Formula | C47H62F6N3O2+ |
| Molecular Weight | 815.02 g/mol |
| Exact Mass | 814.47 |
| IUPAC Name | ethyl-[6-[ethyl(2,2,2-trifluoroethyl)amino]-9-[2-[methyl-[(E)-octadec-9-enyl]carbamoyl]phenyl]xanthen-3-ylidene]-(2,2,2-trifluoroethyl)azanium |
| SMILES | CCCCCCCC/C=C/CCCCCCCCN(C)C(=O)c1ccccc1-c1c2cc/c(=[N+](/CC)CC(F)(F)F)cc-2oc2cc(N(CC)CC(F)(F)F)ccc12 |
| InChI | InChI=1S/C47H62F6N3O2/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-31-54(4)45(57)39-26-23-22-25-38(39)44-40-29-27-36(55(6-2)34-46(48,49)50)32-42(40)58-43-33-37(28-30-41(43)44)56(7-3)35-47(51,52)53/h14-15,22-23,25-30,32-33H,5-13,16-21,24,31,34-35H2,1-4H3/q+1/b15-14+ |
| InChIKey | MQLMEVJINBJNLA-CCEZHUSRSA-N |
| XLogP | 13.06 |
| TPSA | 39.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.02 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|