C39H50N3O3+ — CID 157170794
diethyl-[6-methyl-9-[2-[methyl-[3-[[(E)-8-methylnon-6-enyl]amino]-3-oxopropyl]carbamoyl]phenyl]xanthen-3-ylidene]azanium (PubChem CID 157170794) has the molecular formula C39H50N3O3+ and a molecular weight of 608.85 g/mol. Its IUPAC name is diethyl-[6-methyl-9-[2-[methyl-[3-[[(E)-8-methylnon-6-enyl]amino]-3-oxopropyl]carbamoyl]phenyl]xanthen-3-ylidene]azanium.
| Compound Name | diethyl-[6-methyl-9-[2-[methyl-[3-[[(E)-8-methylnon-6-enyl]amino]-3-oxopropyl]carbamoyl]phenyl]xanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 157170794 |
| Molecular Formula | C39H50N3O3+ |
| Molecular Weight | 608.85 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | diethyl-[6-methyl-9-[2-[methyl-[3-[[(E)-8-methylnon-6-enyl]amino]-3-oxopropyl]carbamoyl]phenyl]xanthen-3-ylidene]azanium |
| SMILES | CC[N+](CC)=c1ccc2c(-c3ccccc3C(=O)N(C)CCC(=O)NCCCCC/C=C/C(C)C)c3ccc(C)cc3oc-2c1 |
| InChI | InChI=1S/C39H49N3O3/c1-7-42(8-2)30-20-22-34-36(27-30)45-35-26-29(5)19-21-33(35)38(34)31-17-13-14-18-32(31)39(44)41(6)25-23-37(43)40-24-15-11-9-10-12-16-28(3)4/h12-14,16-22,26-28H,7-11,15,23-25H2,1-6H3/p+1/b16-12+ |
| InChIKey | FRYHBOKPCVNHKG-FOWTUZBSSA-O |
| XLogP | 7.68 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.85 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|