C35H44N3O5+ — CID 58174025
diethyl-[9-[2-[2-(6-hydroxyhexylcarbamoyloxy)ethyl-methylcarbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium (PubChem CID 58174025) has the molecular formula C35H44N3O5+ and a molecular weight of 586.75 g/mol. Its IUPAC name is diethyl-[9-[2-[2-(6-hydroxyhexylcarbamoyloxy)ethyl-methylcarbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium.
| Compound Name | diethyl-[9-[2-[2-(6-hydroxyhexylcarbamoyloxy)ethyl-methylcarbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 58174025 |
| Molecular Formula | C35H44N3O5+ |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | diethyl-[9-[2-[2-(6-hydroxyhexylcarbamoyloxy)ethyl-methylcarbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium |
| SMILES | CC[N+](CC)=c1ccc2c(-c3ccccc3C(=O)N(C)CCOC(=O)NCCCCCCO)c3ccc(C)cc3oc-2c1 |
| InChI | InChI=1S/C35H43N3O5/c1-5-38(6-2)26-16-18-30-32(24-26)43-31-23-25(3)15-17-29(31)33(30)27-13-9-10-14-28(27)34(40)37(4)20-22-42-35(41)36-19-11-7-8-12-21-39/h9-10,13-18,23-24,39H,5-8,11-12,19-22H2,1-4H3/p+1 |
| InChIKey | JKROKJWMGMRHOH-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|