C30H35N2O3+ — CID 58174024
diethyl-[9-[2-[4-hydroxybutyl(methyl)carbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium (PubChem CID 58174024) has the molecular formula C30H35N2O3+ and a molecular weight of 471.62 g/mol. Its IUPAC name is diethyl-[9-[2-[4-hydroxybutyl(methyl)carbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium.
| Compound Name | diethyl-[9-[2-[4-hydroxybutyl(methyl)carbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium |
|---|---|
| PubChem CID | 58174024 |
| Molecular Formula | C30H35N2O3+ |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | diethyl-[9-[2-[4-hydroxybutyl(methyl)carbamoyl]phenyl]-6-methylxanthen-3-ylidene]azanium |
| SMILES | CC[N+](CC)=c1ccc2c(-c3ccccc3C(=O)N(C)CCCCO)c3ccc(C)cc3oc-2c1 |
| InChI | InChI=1S/C30H35N2O3/c1-5-32(6-2)22-14-16-26-28(20-22)35-27-19-21(3)13-15-25(27)29(26)23-11-7-8-12-24(23)30(34)31(4)17-9-10-18-33/h7-8,11-16,19-20,33H,5-6,9-10,17-18H2,1-4H3/q+1 |
| InChIKey | VJMZUAVJNFJTOO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|