C43H59N4O3+ — CID 118406141
[6-(diethylamino)-9-[2-[4-(9-methyldecanoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 118406141) has the molecular formula C43H59N4O3+ and a molecular weight of 679.97 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[4-(9-methyldecanoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[4-(9-methyldecanoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 118406141 |
| Molecular Formula | C43H59N4O3+ |
| Molecular Weight | 679.97 g/mol |
| Exact Mass | 679.46 |
| IUPAC Name | [6-(diethylamino)-9-[2-[4-(9-methyldecanoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)N3CCN(C(=O)CCCCCCCC(C)C)CC3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C43H59N4O3/c1-7-44(8-2)33-22-24-37-39(30-33)50-40-31-34(45(9-3)10-4)23-25-38(40)42(37)35-19-16-17-20-36(35)43(49)47-28-26-46(27-29-47)41(48)21-15-13-11-12-14-18-32(5)6/h16-17,19-20,22-25,30-32H,7-15,18,21,26-29H2,1-6H3/q+1 |
| InChIKey | QLNYPJXGRKLGKG-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 60.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.97 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|