C40H52N7O3+ — CID 70982298
[9-[2-[4-(8-azidooctanoyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 70982298) has the molecular formula C40H52N7O3+ and a molecular weight of 678.90 g/mol. Its IUPAC name is [9-[2-[4-(8-azidooctanoyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[2-[4-(8-azidooctanoyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 70982298 |
| Molecular Formula | C40H52N7O3+ |
| Molecular Weight | 678.90 g/mol |
| Exact Mass | 678.41 |
| IUPAC Name | [9-[2-[4-(8-azidooctanoyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)N3CCN(C(=O)CCCCCCCN=[N+]=[N-])CC3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C40H52N7O3/c1-5-44(6-2)30-19-21-34-36(28-30)50-37-29-31(45(7-3)8-4)20-22-35(37)39(34)32-16-13-14-17-33(32)40(49)47-26-24-46(25-27-47)38(48)18-12-10-9-11-15-23-42-43-41/h13-14,16-17,19-22,28-29H,5-12,15,18,23-27H2,1-4H3/q+1 |
| InChIKey | NQWXJHZZAKJBIN-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 108.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.90 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|