C46H57N6O4+ — CID 102150491
[6-(diethylamino)-9-[2-[4-[4-[4-(diethylamino)anilino]-4-oxobutanoyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 102150491) has the molecular formula C46H57N6O4+ and a molecular weight of 758.00 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[4-[4-[4-(diethylamino)anilino]-4-oxobutanoyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[4-[4-[4-(diethylamino)anilino]-4-oxobutanoyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 102150491 |
| Molecular Formula | C46H57N6O4+ |
| Molecular Weight | 758.00 g/mol |
| Exact Mass | 757.44 |
| IUPAC Name | [6-(diethylamino)-9-[2-[4-[4-[4-(diethylamino)anilino]-4-oxobutanoyl]piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc(NC(=O)CCC(=O)N2CCN(C(=O)c3ccccc3-c3c4ccc(=[N+](CC)CC)cc-4oc4cc(N(CC)CC)ccc34)CC2)cc1 |
| InChI | InChI=1S/C46H56N6O4/c1-7-48(8-2)34-19-17-33(18-20-34)47-43(53)25-26-44(54)51-27-29-52(30-28-51)46(55)38-16-14-13-15-37(38)45-39-23-21-35(49(9-3)10-4)31-41(39)56-42-32-36(22-24-40(42)45)50(11-5)12-6/h13-24,31-32H,7-12,25-30H2,1-6H3/p+1 |
| InChIKey | KRJUTKJBMBRYBJ-UHFFFAOYSA-O |
| XLogP | 7.41 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.00 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|