C41H55N4O3+ — CID 129024153
[6-(diethylamino)-9-[2-(4-nonanoylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 129024153) has the molecular formula C41H55N4O3+ and a molecular weight of 651.92 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-(4-nonanoylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-(4-nonanoylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 129024153 |
| Molecular Formula | C41H55N4O3+ |
| Molecular Weight | 651.92 g/mol |
| Exact Mass | 651.43 |
| IUPAC Name | [6-(diethylamino)-9-[2-(4-nonanoylpiperazine-1-carbonyl)phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCCCCCCCC(=O)N1CCN(C(=O)c2ccccc2-c2c3ccc(=[N+](CC)CC)cc-3oc3cc(N(CC)CC)ccc23)CC1 |
| InChI | InChI=1S/C41H55N4O3/c1-6-11-12-13-14-15-20-39(46)44-25-27-45(28-26-44)41(47)34-19-17-16-18-33(34)40-35-23-21-31(42(7-2)8-3)29-37(35)48-38-30-32(22-24-36(38)40)43(9-4)10-5/h16-19,21-24,29-30H,6-15,20,25-28H2,1-5H3/q+1 |
| InChIKey | LXWHFLCFNKJTFK-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 60.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.92 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|