C50H71N2O3+ — CID 59987910
cyclohexylmethyl-[6-[cyclohexylmethyl(hexyl)amino]-9-[2-(2-methylpropoxycarbonyl)phenyl]xanthen-3-ylidene]-hexylazanium (PubChem CID 59987910) has the molecular formula C50H71N2O3+ and a molecular weight of 748.13 g/mol. Its IUPAC name is cyclohexylmethyl-[6-[cyclohexylmethyl(hexyl)amino]-9-[2-(2-methylpropoxycarbonyl)phenyl]xanthen-3-ylidene]-hexylazanium.
| Compound Name | cyclohexylmethyl-[6-[cyclohexylmethyl(hexyl)amino]-9-[2-(2-methylpropoxycarbonyl)phenyl]xanthen-3-ylidene]-hexylazanium |
|---|---|
| PubChem CID | 59987910 |
| Molecular Formula | C50H71N2O3+ |
| Molecular Weight | 748.13 g/mol |
| Exact Mass | 747.55 |
| IUPAC Name | cyclohexylmethyl-[6-[cyclohexylmethyl(hexyl)amino]-9-[2-(2-methylpropoxycarbonyl)phenyl]xanthen-3-ylidene]-hexylazanium |
| SMILES | CCCCCCN(CC1CCCCC1)c1ccc2c(-c3ccccc3C(=O)OCC(C)C)c3cc/c(=[N+](/CCCCCC)CC4CCCCC4)cc-3oc2c1 |
| InChI | InChI=1S/C50H71N2O3/c1-5-7-9-19-31-51(35-39-21-13-11-14-22-39)41-27-29-45-47(33-41)55-48-34-42(52(32-20-10-8-6-2)36-40-23-15-12-16-24-40)28-30-46(48)49(45)43-25-17-18-26-44(43)50(53)54-37-38(3)4/h17-18,25-30,33-34,38-40H,5-16,19-24,31-32,35-37H2,1-4H3/q+1 |
| InChIKey | REXZLVFXQBAJRI-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 45.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.13 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|