C36H38N4O9P+ — CID 71160947
[9-[4-[[1-amino-3-oxo-5-(4-phosphonooxyphenyl)pentan-2-yl]carbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 71160947) has the molecular formula C36H38N4O9P+ and a molecular weight of 701.69 g/mol. Its IUPAC name is [9-[4-[[1-amino-3-oxo-5-(4-phosphonooxyphenyl)pentan-2-yl]carbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[4-[[1-amino-3-oxo-5-(4-phosphonooxyphenyl)pentan-2-yl]carbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 71160947 |
| Molecular Formula | C36H38N4O9P+ |
| Molecular Weight | 701.69 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | [9-[4-[[1-amino-3-oxo-5-(4-phosphonooxyphenyl)pentan-2-yl]carbamoyl]-2-carboxyphenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NC(CN)C(=O)CCc4ccc(OP(=O)(O)O)cc4)cc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C36H37N4O9P/c1-39(2)23-9-14-27-32(18-23)48-33-19-24(40(3)4)10-15-28(33)34(27)26-13-8-22(17-29(26)36(43)44)35(42)38-30(20-37)31(41)16-7-21-5-11-25(12-6-21)49-50(45,46)47/h5-6,8-15,17-19,30H,7,16,20,37H2,1-4H3,(H3-,38,42,43,44,45,46,47)/p+1 |
| InChIKey | GMPMAVVRTMDHAQ-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 195.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|