C29H32N3O4+ — CID 163933384
[9-[4-carboxy-2-(2-methylpropylcarbamoyl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 163933384) has the molecular formula C29H32N3O4+ and a molecular weight of 486.59 g/mol. Its IUPAC name is [9-[4-carboxy-2-(2-methylpropylcarbamoyl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[4-carboxy-2-(2-methylpropylcarbamoyl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 163933384 |
| Molecular Formula | C29H32N3O4+ |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [9-[4-carboxy-2-(2-methylpropylcarbamoyl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CC(C)CNC(=O)c1cc(C(=O)O)ccc1-c1c2ccc(=[N+](C)C)cc-2oc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C29H31N3O4/c1-17(2)16-30-28(33)24-13-18(29(34)35)7-10-21(24)27-22-11-8-19(31(3)4)14-25(22)36-26-15-20(32(5)6)9-12-23(26)27/h7-15,17H,16H2,1-6H3,(H-,30,33,34,35)/p+1 |
| InChIKey | HJXFNPOSEWOYQX-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|