C24H22CoN2O3 — CID 145288134
[9-(3-carboxybenzene-6-id-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;cobalt (PubChem CID 145288134) has the molecular formula C24H22CoN2O3 and a molecular weight of 445.38 g/mol. Its IUPAC name is [9-(3-carboxybenzene-6-id-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;cobalt.
| Compound Name | [9-(3-carboxybenzene-6-id-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;cobalt |
|---|---|
| PubChem CID | 145288134 |
| Molecular Formula | C24H22CoN2O3 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | [9-(3-carboxybenzene-6-id-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;cobalt |
| SMILES | CN(C)c1ccc2c(-c3[c-]ccc(C(=O)O)c3)c3ccc(=[N+](C)C)cc-3oc2c1.[Co] |
| InChI | InChI=1S/C24H22N2O3.Co/c1-25(2)17-8-10-19-21(13-17)29-22-14-18(26(3)4)9-11-20(22)23(19)15-6-5-7-16(12-15)24(27)28;/h5,7-14H,1-4H3,(H,27,28); |
| InChIKey | CEICUCBQXCNIFB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|