C29H24N3O7+ — CID 158668375
[9-[2,6-dicarboxy-4-(2,5-dioxopyrrol-1-yl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 158668375) has the molecular formula C29H24N3O7+ and a molecular weight of 526.53 g/mol. Its IUPAC name is [9-[2,6-dicarboxy-4-(2,5-dioxopyrrol-1-yl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2,6-dicarboxy-4-(2,5-dioxopyrrol-1-yl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 158668375 |
| Molecular Formula | C29H24N3O7+ |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | [9-[2,6-dicarboxy-4-(2,5-dioxopyrrol-1-yl)phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3c(C(=O)O)cc(N4C(=O)C=CC4=O)cc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C29H23N3O7/c1-30(2)15-5-7-18-22(13-15)39-23-14-16(31(3)4)6-8-19(23)26(18)27-20(28(35)36)11-17(12-21(27)29(37)38)32-24(33)9-10-25(32)34/h5-14H,1-4H3,(H-,35,36,37,38)/p+1 |
| InChIKey | MUJROBYMGDTJRT-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|