C28H32N3O5S+ — CID 59695517
[9-[4-(tert-butylcarbamoyl)-2-sulfophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 59695517) has the molecular formula C28H32N3O5S+ and a molecular weight of 522.65 g/mol. Its IUPAC name is [9-[4-(tert-butylcarbamoyl)-2-sulfophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[4-(tert-butylcarbamoyl)-2-sulfophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 59695517 |
| Molecular Formula | C28H32N3O5S+ |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [9-[4-(tert-butylcarbamoyl)-2-sulfophenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NC(C)(C)C)cc3S(=O)(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C28H31N3O5S/c1-28(2,3)29-27(32)17-8-11-22(25(14-17)37(33,34)35)26-20-12-9-18(30(4)5)15-23(20)36-24-16-19(31(6)7)10-13-21(24)26/h8-16H,1-7H3,(H-,29,32,33,34,35)/p+1 |
| InChIKey | QMGFTPMUNFHETJ-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|