C31H28N2O7 — CID 21135138
5-[[6-(but-2-ynylamino)-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 21135138) has the molecular formula C31H28N2O7 and a molecular weight of 540.57 g/mol. Its IUPAC name is 5-[[6-(but-2-ynylamino)-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[6-(but-2-ynylamino)-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 21135138 |
| Molecular Formula | C31H28N2O7 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 5-[[6-(but-2-ynylamino)-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC#CCNC(=O)CCCCCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H28N2O7/c1-2-3-14-32-28(36)7-5-4-6-15-33-30(37)19-8-11-22(25(16-19)31(38)39)29-23-12-9-20(34)17-26(23)40-27-18-21(35)10-13-24(27)29/h8-13,16-18,34H,4-7,14-15H2,1H3,(H,32,36)(H,33,37)(H,38,39) |
| InChIKey | LUXHFZHZJIFJPL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|