C41H50N2O7 — CID 122403560
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[[(Z)-octadec-9-enoyl]amino]ethylcarbamoyl]benzoic acid (PubChem CID 122403560) has the molecular formula C41H50N2O7 and a molecular weight of 682.86 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[[(Z)-octadec-9-enoyl]amino]ethylcarbamoyl]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[[(Z)-octadec-9-enoyl]amino]ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 122403560 |
| Molecular Formula | C41H50N2O7 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.36 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[[(Z)-octadec-9-enoyl]amino]ethylcarbamoyl]benzoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C41H50N2O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-38(46)42-24-25-43-40(47)29-18-21-32(35(26-29)41(48)49)39-33-22-19-30(44)27-36(33)50-37-28-31(45)20-23-34(37)39/h9-10,18-23,26-28,44H,2-8,11-17,24-25H2,1H3,(H,42,46)(H,43,47)(H,48,49)/b10-9- |
| InChIKey | PSACDWHHRCKCBS-KTKRTIGZSA-N |
| XLogP | 8.85 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|