C35H40N4O10 — CID 153290906
5-[2-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 153290906) has the molecular formula C35H40N4O10 and a molecular weight of 676.72 g/mol. Its IUPAC name is 5-[2-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[2-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 153290906 |
| Molecular Formula | C35H40N4O10 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | 5-[2-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CNCCCCC(NC(=O)CCOCCOCCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)C(N)=O |
| InChI | InChI=1S/C35H40N4O10/c1-37-12-3-2-4-28(33(36)43)39-31(42)11-14-47-16-17-48-15-13-38-34(44)21-5-8-24(27(18-21)35(45)46)32-25-9-6-22(40)19-29(25)49-30-20-23(41)7-10-26(30)32/h5-10,18-20,28,37,40H,2-4,11-17H2,1H3,(H2,36,43)(H,38,44)(H,39,42)(H,45,46) |
| InChIKey | DITVUWZVLBMYTG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 219.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|