C33H38N4O15P2 — CID 154976091
4-[[5-(3-aminopropanoylamino)-6-[(3-hydroxy-3,3-diphosphonopropyl)amino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 154976091) has the molecular formula C33H38N4O15P2 and a molecular weight of 792.63 g/mol. Its IUPAC name is 4-[[5-(3-aminopropanoylamino)-6-[(3-hydroxy-3,3-diphosphonopropyl)amino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-[[5-(3-aminopropanoylamino)-6-[(3-hydroxy-3,3-diphosphonopropyl)amino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 154976091 |
| Molecular Formula | C33H38N4O15P2 |
| Molecular Weight | 792.63 g/mol |
| Exact Mass | 792.18 |
| IUPAC Name | 4-[[5-(3-aminopropanoylamino)-6-[(3-hydroxy-3,3-diphosphonopropyl)amino]-6-oxohexyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | NCCC(=O)NC(CCCCNC(=O)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1)C(=O)NCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C33H38N4O15P2/c34-12-10-28(40)37-25(31(42)36-14-11-33(45,53(46,47)48)54(49,50)51)3-1-2-13-35-30(41)18-4-7-21(32(43)44)24(15-18)29-22-8-5-19(38)16-26(22)52-27-17-20(39)6-9-23(27)29/h4-9,15-17,25,38,45H,1-3,10-14,34H2,(H,35,41)(H,36,42)(H,37,40)(H,43,44)(H2,46,47,48)(H2,49,50,51) |
| InChIKey | MZILNFVPYPWKMP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 336.35 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|