C33H36N4O9 — CID 153290907
5-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 153290907) has the molecular formula C33H36N4O9 and a molecular weight of 632.67 g/mol. Its IUPAC name is 5-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 153290907 |
| Molecular Formula | C33H36N4O9 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 5-[2-[3-[[1-amino-6-(methylamino)-1-oxohexan-2-yl]amino]-3-oxopropoxy]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CNCCCCC(NC(=O)CCOCCNC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)C(N)=O |
| InChI | InChI=1S/C33H36N4O9/c1-35-12-3-2-4-26(31(34)41)37-29(40)11-14-45-15-13-36-32(42)19-5-8-22(25(16-19)33(43)44)30-23-9-6-20(38)17-27(23)46-28-18-21(39)7-10-24(28)30/h5-10,16-18,26,35,38H,2-4,11-15H2,1H3,(H2,34,41)(H,36,42)(H,37,40)(H,43,44) |
| InChIKey | SNJDQQPYAQANDM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 210.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|