C22H15NO6 — CID 87132005
4-(2-aminoacetyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 87132005) has the molecular formula C22H15NO6 and a molecular weight of 389.36 g/mol. Its IUPAC name is 4-(2-aminoacetyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-(2-aminoacetyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 87132005 |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-(2-aminoacetyl)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | NCC(=O)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C22H15NO6/c23-10-18(26)11-1-4-14(22(27)28)17(7-11)21-15-5-2-12(24)8-19(15)29-20-9-13(25)3-6-16(20)21/h1-9,24H,10,23H2,(H,27,28) |
| InChIKey | DKBGCKUHBAETCF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|