C21H14ClNO6 — CID 135955112
[9-(2,5-dicarboxyphenyl)-6-oxoxanthen-3-yl]azanium chloride (PubChem CID 135955112) has the molecular formula C21H14ClNO6 and a molecular weight of 411.80 g/mol. Its IUPAC name is [9-(2,5-dicarboxyphenyl)-6-oxoxanthen-3-yl]azanium chloride.
| Compound Name | [9-(2,5-dicarboxyphenyl)-6-oxoxanthen-3-yl]azanium chloride |
|---|---|
| PubChem CID | 135955112 |
| Molecular Formula | C21H14ClNO6 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [9-(2,5-dicarboxyphenyl)-6-oxoxanthen-3-yl]azanium chloride |
| SMILES | [Cl-].[NH3+]c1ccc2c(-c3cc(C(=O)O)ccc3C(=O)O)c3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C21H13NO6.ClH/c22-11-2-5-14-17(8-11)28-18-9-12(23)3-6-15(18)19(14)16-7-10(20(24)25)1-4-13(16)21(26)27;/h1-9H,22H2,(H,24,25)(H,26,27);1H |
| InChIKey | JSKUVILDYVDLCD-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|