C21H14O8 — CID 20793710
4-(3-hydroxy-6-oxoxanthen-9-yl)-3-(trihydroxymethyl)benzoic acid (PubChem CID 20793710) has the molecular formula C21H14O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-(3-hydroxy-6-oxoxanthen-9-yl)-3-(trihydroxymethyl)benzoic acid.
| Compound Name | 4-(3-hydroxy-6-oxoxanthen-9-yl)-3-(trihydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 20793710 |
| Molecular Formula | C21H14O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-(3-hydroxy-6-oxoxanthen-9-yl)-3-(trihydroxymethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(O)(O)O)c1 |
| InChI | InChI=1S/C21H14O8/c22-11-2-5-14-17(8-11)29-18-9-12(23)3-6-15(18)19(14)13-4-1-10(20(24)25)7-16(13)21(26,27)28/h1-9,22,26-28H,(H,24,25) |
| InChIKey | MHKRUBRHFXJUPC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|