C23H22O3 — CID 144831515
9-(2,4-dimethylphenyl)-6-hydroxyxanthen-3-one;ethane (PubChem CID 144831515) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 9-(2,4-dimethylphenyl)-6-hydroxyxanthen-3-one;ethane.
| Compound Name | 9-(2,4-dimethylphenyl)-6-hydroxyxanthen-3-one;ethane |
|---|---|
| PubChem CID | 144831515 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 9-(2,4-dimethylphenyl)-6-hydroxyxanthen-3-one;ethane |
| SMILES | CC.Cc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C)c1 |
| InChI | InChI=1S/C21H16O3.C2H6/c1-12-3-6-16(13(2)9-12)21-17-7-4-14(22)10-19(17)24-20-11-15(23)5-8-18(20)21;1-2/h3-11,22H,1-2H3;1-2H3 |
| InChIKey | HJFDHLVFSLPNTC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|