About CID 177485324
CID 177485324 (PubChem CID 177485324) has the molecular formula C20H13O3Se
and a molecular weight of 380.28 g/mol.
Molecular Properties
| Compound Name | CID 177485324 |
| PubChem CID | 177485324 |
| Molecular Formula | C20H13O3Se |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | — |
| SMILES | O=c1ccc2c(-c3ccccc3C[Se])c3ccc(O)cc3oc-2c1 |
| InChI | InChI=1S/C20H13O3Se/c21-13-5-7-16-18(9-13)23-19-10-14(22)6-8-17(19)20(16)15-4-2-1-3-12(15)11-24/h1-10,21H,11H2 |
| InChIKey | GAFSQTOSKDLSHG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 177485324 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177485324?
The IUPAC name of CID 177485324 (CID 177485324) is not available.
What is the SMILES notation for CID 177485324?
The canonical SMILES for CID 177485324 is O=c1ccc2c(-c3ccccc3C[Se])c3ccc(O)cc3oc-2c1.
What is the InChIKey of CID 177485324?
The InChIKey is GAFSQTOSKDLSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13O3Se/c21-13-5-7-16-18(9-13)23-19-10-14(22)6-8-17(19)20(16)15-4-2-1-3-12(15)11-24/h1-10,21H,11H2.
What are the key properties of CID 177485324?
CID 177485324 has a molecular weight of 380.28 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177485324 is sourced from PubChem (CID 177485324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).