C30H28O7 — CID 167576268
2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(8-oxodecanoyl)benzoic acid (PubChem CID 167576268) has the molecular formula C30H28O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(8-oxodecanoyl)benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(8-oxodecanoyl)benzoic acid |
|---|---|
| PubChem CID | 167576268 |
| Molecular Formula | C30H28O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(8-oxodecanoyl)benzoic acid |
| SMILES | CCC(=O)CCCCCCC(=O)c1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C30H28O7/c1-2-19(31)7-5-3-4-6-8-26(34)18-9-12-22(30(35)36)25(15-18)29-23-13-10-20(32)16-27(23)37-28-17-21(33)11-14-24(28)29/h9-17,32H,2-8H2,1H3,(H,35,36) |
| InChIKey | GOQQLCQVLWZBEI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|