C38H46O13 — CID 159496593
5-[4-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 159496593) has the molecular formula C38H46O13 and a molecular weight of 710.77 g/mol. Its IUPAC name is 5-[4-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[4-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 159496593 |
| Molecular Formula | C38H46O13 |
| Molecular Weight | 710.77 g/mol |
| Exact Mass | 710.29 |
| IUPAC Name | 5-[4-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CCOCCOCCOCCOCCOCCOCCOCCCC(=O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C38H46O13/c1-2-44-12-13-46-16-17-48-20-21-50-23-22-49-19-18-47-15-14-45-11-3-4-34(41)27-5-8-30(33(24-27)38(42)43)37-31-9-6-28(39)25-35(31)51-36-26-29(40)7-10-32(36)37/h5-10,24-26,39H,2-4,11-23H2,1H3,(H,42,43) |
| InChIKey | OAVFPSNDTFSBNJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|