C44H47NO12 — CID 58481152
4-[5-[2-[2-[8-(3-amino-4-formylphenoxy)-5-oxooctoxy]ethoxy]ethoxy]pentanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 58481152) has the molecular formula C44H47NO12 and a molecular weight of 781.85 g/mol. Its IUPAC name is 4-[5-[2-[2-[8-(3-amino-4-formylphenoxy)-5-oxooctoxy]ethoxy]ethoxy]pentanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4-[5-[2-[2-[8-(3-amino-4-formylphenoxy)-5-oxooctoxy]ethoxy]ethoxy]pentanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 58481152 |
| Molecular Formula | C44H47NO12 |
| Molecular Weight | 781.85 g/mol |
| Exact Mass | 781.31 |
| IUPAC Name | 4-[5-[2-[2-[8-(3-amino-4-formylphenoxy)-5-oxooctoxy]ethoxy]ethoxy]pentanoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1cc(OCCCC(=O)CCCCOCCOCCOCCCCC(=O)c2ccc(C(=O)O)c(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)c2)ccc1C=O |
| InChI | InChI=1S/C44H47NO12/c45-39-27-34(13-9-30(39)28-46)56-19-5-7-31(47)6-1-3-17-53-20-22-55-23-21-54-18-4-2-8-40(50)29-10-14-35(44(51)52)38(24-29)43-36-15-11-32(48)25-41(36)57-42-26-33(49)12-16-37(42)43/h9-16,24-28,48H,1-8,17-23,45H2,(H,51,52) |
| InChIKey | XYWLEHHSIBWIGG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 201.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.85 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|